C13H24N4S — CID 114174001
2-methyl-1-[3-(2-thiomorpholin-4-ylethyl)imidazol-4-yl]propan-1-amine (PubChem CID 114174001) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-thiomorpholin-4-ylethyl)imidazol-4-yl]propan-1-amine.
| Compound Name | 2-methyl-1-[3-(2-thiomorpholin-4-ylethyl)imidazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 114174001 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | 2-methyl-1-[3-(2-thiomorpholin-4-ylethyl)imidazol-4-yl]propan-1-amine |
| SMILES | CC(C)C(N)c1cncn1CCN1CCSCC1 |
| InChI | InChI=1S/C13H24N4S/c1-11(2)13(14)12-9-15-10-17(12)4-3-16-5-7-18-8-6-16/h9-11,13H,3-8,14H2,1-2H3 |
| InChIKey | SVQXUANQERCKDM-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |