C12H23N3S — CID 102969894
1-[3-(1-ethylsulfanylpropan-2-yl)imidazol-4-yl]-2-methylpropan-1-amine (PubChem CID 102969894) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is 1-[3-(1-ethylsulfanylpropan-2-yl)imidazol-4-yl]-2-methylpropan-1-amine.
| Compound Name | 1-[3-(1-ethylsulfanylpropan-2-yl)imidazol-4-yl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 102969894 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 1-[3-(1-ethylsulfanylpropan-2-yl)imidazol-4-yl]-2-methylpropan-1-amine |
| SMILES | CCSCC(C)n1cncc1C(N)C(C)C |
| InChI | InChI=1S/C12H23N3S/c1-5-16-7-10(4)15-8-14-6-11(15)12(13)9(2)3/h6,8-10,12H,5,7,13H2,1-4H3 |
| InChIKey | IDTCEAVQOAFDAG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |