C16H21N3O — CID 102970575
[5-(3,5-dimethylphenyl)-1H-imidazol-2-yl]-(oxolan-3-yl)methanamine (PubChem CID 102970575) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is [5-(3,5-dimethylphenyl)-1H-imidazol-2-yl]-(oxolan-3-yl)methanamine.
| Compound Name | [5-(3,5-dimethylphenyl)-1H-imidazol-2-yl]-(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 102970575 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | [5-(3,5-dimethylphenyl)-1H-imidazol-2-yl]-(oxolan-3-yl)methanamine |
| SMILES | Cc1cc(C)cc(-c2cnc(C(N)C3CCOC3)[nH]2)c1 |
| InChI | InChI=1S/C16H21N3O/c1-10-5-11(2)7-13(6-10)14-8-18-16(19-14)15(17)12-3-4-20-9-12/h5-8,12,15H,3-4,9,17H2,1-2H3,(H,18,19) |
| InChIKey | QMDRHUYSDSXCIY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |