C15H22O3 — CID 113449299
1-(oxolan-3-yl)-2-(2,4,6-trimethylphenoxy)ethanol (PubChem CID 113449299) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(oxolan-3-yl)-2-(2,4,6-trimethylphenoxy)ethanol.
| Compound Name | 1-(oxolan-3-yl)-2-(2,4,6-trimethylphenoxy)ethanol |
|---|---|
| PubChem CID | 113449299 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-(oxolan-3-yl)-2-(2,4,6-trimethylphenoxy)ethanol |
| SMILES | Cc1cc(C)c(OCC(O)C2CCOC2)c(C)c1 |
| InChI | InChI=1S/C15H22O3/c1-10-6-11(2)15(12(3)7-10)18-9-14(16)13-4-5-17-8-13/h6-7,13-14,16H,4-5,8-9H2,1-3H3 |
| InChIKey | PWDSBVCZJGTWEA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |