C13H19NO4S — CID 102970801
[4-(3-methoxypiperidin-1-yl)sulfonylphenyl]methanol (PubChem CID 102970801) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is [4-(3-methoxypiperidin-1-yl)sulfonylphenyl]methanol.
| Compound Name | [4-(3-methoxypiperidin-1-yl)sulfonylphenyl]methanol |
|---|---|
| PubChem CID | 102970801 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | [4-(3-methoxypiperidin-1-yl)sulfonylphenyl]methanol |
| SMILES | COC1CCCN(S(=O)(=O)c2ccc(CO)cc2)C1 |
| InChI | InChI=1S/C13H19NO4S/c1-18-12-3-2-8-14(9-12)19(16,17)13-6-4-11(10-15)5-7-13/h4-7,12,15H,2-3,8-10H2,1H3 |
| InChIKey | HOWQAGGJIMUCFD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |