C15H23NO4S — CID 102970802
3-[4-(3-methoxypiperidin-1-yl)sulfonylphenyl]propan-1-ol (PubChem CID 102970802) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-[4-(3-methoxypiperidin-1-yl)sulfonylphenyl]propan-1-ol.
| Compound Name | 3-[4-(3-methoxypiperidin-1-yl)sulfonylphenyl]propan-1-ol |
|---|---|
| PubChem CID | 102970802 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-[4-(3-methoxypiperidin-1-yl)sulfonylphenyl]propan-1-ol |
| SMILES | COC1CCCN(S(=O)(=O)c2ccc(CCCO)cc2)C1 |
| InChI | InChI=1S/C15H23NO4S/c1-20-14-5-2-10-16(12-14)21(18,19)15-8-6-13(7-9-15)4-3-11-17/h6-9,14,17H,2-5,10-12H2,1H3 |
| InChIKey | VBQMHLNDCQNILQ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |