C11H15BrN2O5S — CID 102970878
2-bromo-5-(3-methoxypiperidine-1-carbonyl)furan-3-sulfonamide (PubChem CID 102970878) has the molecular formula C11H15BrN2O5S and a molecular weight of 367.22 g/mol. Its IUPAC name is 2-bromo-5-(3-methoxypiperidine-1-carbonyl)furan-3-sulfonamide.
| Compound Name | 2-bromo-5-(3-methoxypiperidine-1-carbonyl)furan-3-sulfonamide |
|---|---|
| PubChem CID | 102970878 |
| Molecular Formula | C11H15BrN2O5S |
| Molecular Weight | 367.22 g/mol |
| Exact Mass | 365.99 |
| IUPAC Name | 2-bromo-5-(3-methoxypiperidine-1-carbonyl)furan-3-sulfonamide |
| SMILES | COC1CCCN(C(=O)c2cc(S(N)(=O)=O)c(Br)o2)C1 |
| InChI | InChI=1S/C11H15BrN2O5S/c1-18-7-3-2-4-14(6-7)11(15)8-5-9(10(12)19-8)20(13,16)17/h5,7H,2-4,6H2,1H3,(H2,13,16,17) |
| InChIKey | OCWDBWLAEZLVSC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |