C12H16N2O6S — CID 125132918
(3R)-1-(5-methyl-4-sulfamoylfuran-2-carbonyl)piperidine-3-carboxylic acid (PubChem CID 125132918) has the molecular formula C12H16N2O6S and a molecular weight of 316.34 g/mol. Its IUPAC name is (3R)-1-(5-methyl-4-sulfamoylfuran-2-carbonyl)piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-(5-methyl-4-sulfamoylfuran-2-carbonyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 125132918 |
| Molecular Formula | C12H16N2O6S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (3R)-1-(5-methyl-4-sulfamoylfuran-2-carbonyl)piperidine-3-carboxylic acid |
| SMILES | Cc1oc(C(=O)N2CCC[C@@H](C(=O)O)C2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H16N2O6S/c1-7-10(21(13,18)19)5-9(20-7)11(15)14-4-2-3-8(6-14)12(16)17/h5,8H,2-4,6H2,1H3,(H,16,17)(H2,13,18,19)/t8-/m1/s1 |
| InChIKey | XPACHTMZVIOLHG-MRVPVSSYSA-N |
| XLogP | 0.17 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |