C17H26N2O4S — CID 55761088
(3-ethylpiperidin-1-yl)-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-yl)methanone (PubChem CID 55761088) has the molecular formula C17H26N2O4S and a molecular weight of 354.47 g/mol. Its IUPAC name is (3-ethylpiperidin-1-yl)-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-yl)methanone.
| Compound Name | (3-ethylpiperidin-1-yl)-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 55761088 |
| Molecular Formula | C17H26N2O4S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (3-ethylpiperidin-1-yl)-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-yl)methanone |
| SMILES | CCC1CCCN(C(=O)c2cc(S(=O)(=O)N3CCCC3)c(C)o2)C1 |
| InChI | InChI=1S/C17H26N2O4S/c1-3-14-7-6-8-18(12-14)17(20)15-11-16(13(2)23-15)24(21,22)19-9-4-5-10-19/h11,14H,3-10,12H2,1-2H3 |
| InChIKey | XORFSDSJNZRQPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |