C15H20N2O7S — CID 119239175
4-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)morpholine-2-carboxylic acid (PubChem CID 119239175) has the molecular formula C15H20N2O7S and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)morpholine-2-carboxylic acid.
| Compound Name | 4-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 119239175 |
| Molecular Formula | C15H20N2O7S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 4-(5-methyl-4-pyrrolidin-1-ylsulfonylfuran-2-carbonyl)morpholine-2-carboxylic acid |
| SMILES | Cc1oc(C(=O)N2CCOC(C(=O)O)C2)cc1S(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C15H20N2O7S/c1-10-13(25(21,22)17-4-2-3-5-17)8-11(24-10)14(18)16-6-7-23-12(9-16)15(19)20/h8,12H,2-7,9H2,1H3,(H,19,20) |
| InChIKey | GXJLECXKFWKCHV-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 117.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |