C12H16N2O7S — CID 125120389
(2R)-4-[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]morpholine-2-carboxylic acid (PubChem CID 125120389) has the molecular formula C12H16N2O7S and a molecular weight of 332.33 g/mol. Its IUPAC name is (2R)-4-[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]morpholine-2-carboxylic acid.
| Compound Name | (2R)-4-[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 125120389 |
| Molecular Formula | C12H16N2O7S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (2R)-4-[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]morpholine-2-carboxylic acid |
| SMILES | CNS(=O)(=O)c1cc(C(=O)N2CCO[C@@H](C(=O)O)C2)c(C)o1 |
| InChI | InChI=1S/C12H16N2O7S/c1-7-8(5-10(21-7)22(18,19)13-2)11(15)14-3-4-20-9(6-14)12(16)17/h5,9,13H,3-4,6H2,1-2H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | RKVVKZYAQYMERQ-SECBINFHSA-N |
| XLogP | -0.58 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |