C11H16N2O5S — CID 94023334
N-methyl-5-[(2R)-2-methylmorpholine-4-carbonyl]furan-2-sulfonamide (PubChem CID 94023334) has the molecular formula C11H16N2O5S and a molecular weight of 288.32 g/mol. Its IUPAC name is N-methyl-5-[(2R)-2-methylmorpholine-4-carbonyl]furan-2-sulfonamide.
| Compound Name | N-methyl-5-[(2R)-2-methylmorpholine-4-carbonyl]furan-2-sulfonamide |
|---|---|
| PubChem CID | 94023334 |
| Molecular Formula | C11H16N2O5S |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-methyl-5-[(2R)-2-methylmorpholine-4-carbonyl]furan-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N2CCO[C@H](C)C2)o1 |
| InChI | InChI=1S/C11H16N2O5S/c1-8-7-13(5-6-17-8)11(14)9-3-4-10(18-9)19(15,16)12-2/h3-4,8,12H,5-7H2,1-2H3/t8-/m1/s1 |
| InChIKey | CHNYRTYBLKGHQF-MRVPVSSYSA-N |
| XLogP | 0.05 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |