C13H21N3O4S — CID 124592409
5-[(3R)-3-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-N-methylfuran-2-sulfonamide (PubChem CID 124592409) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is 5-[(3R)-3-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-N-methylfuran-2-sulfonamide.
| Compound Name | 5-[(3R)-3-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-N-methylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 124592409 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 5-[(3R)-3-[(1S)-1-aminoethyl]piperidine-1-carbonyl]-N-methylfuran-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N2CCC[C@@H]([C@H](C)N)C2)o1 |
| InChI | InChI=1S/C13H21N3O4S/c1-9(14)10-4-3-7-16(8-10)13(17)11-5-6-12(20-11)21(18,19)15-2/h5-6,9-10,15H,3-4,7-8,14H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | JCXOUKJELFCZEM-VHSXEESVSA-N |
| XLogP | 0.39 |
| TPSA | 105.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |