C11H14N2O5S — CID 112531251
N-methyl-5-(4-oxopiperidine-1-carbonyl)furan-2-sulfonamide (PubChem CID 112531251) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is N-methyl-5-(4-oxopiperidine-1-carbonyl)furan-2-sulfonamide.
| Compound Name | N-methyl-5-(4-oxopiperidine-1-carbonyl)furan-2-sulfonamide |
|---|---|
| PubChem CID | 112531251 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | N-methyl-5-(4-oxopiperidine-1-carbonyl)furan-2-sulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(C(=O)N2CCC(=O)CC2)o1 |
| InChI | InChI=1S/C11H14N2O5S/c1-12-19(16,17)10-3-2-9(18-10)11(15)13-6-4-8(14)5-7-13/h2-3,12H,4-7H2,1H3 |
| InChIKey | KOHNHKZFOPAYGZ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |