C14H23N3O5S — CID 56803099
5-[4-(2-hydroxybutyl)piperazine-1-carbonyl]-N-methylfuran-2-sulfonamide (PubChem CID 56803099) has the molecular formula C14H23N3O5S and a molecular weight of 345.42 g/mol. Its IUPAC name is 5-[4-(2-hydroxybutyl)piperazine-1-carbonyl]-N-methylfuran-2-sulfonamide.
| Compound Name | 5-[4-(2-hydroxybutyl)piperazine-1-carbonyl]-N-methylfuran-2-sulfonamide |
|---|---|
| PubChem CID | 56803099 |
| Molecular Formula | C14H23N3O5S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 5-[4-(2-hydroxybutyl)piperazine-1-carbonyl]-N-methylfuran-2-sulfonamide |
| SMILES | CCC(O)CN1CCN(C(=O)c2ccc(S(=O)(=O)NC)o2)CC1 |
| InChI | InChI=1S/C14H23N3O5S/c1-3-11(18)10-16-6-8-17(9-7-16)14(19)12-4-5-13(22-12)23(20,21)15-2/h4-5,11,15,18H,3,6-10H2,1-2H3 |
| InChIKey | PYSIBYVKNFGPAK-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |