C11H10N4O4 — CID 102973959
4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]pyrimidine-5-carboxylic acid (PubChem CID 102973959) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is 4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 102973959 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 4-[(4-methyl-2,3-dioxopyrazin-1-yl)methyl]pyrimidine-5-carboxylic acid |
| SMILES | Cn1ccn(Cc2ncncc2C(=O)O)c(=O)c1=O |
| InChI | InChI=1S/C11H10N4O4/c1-14-2-3-15(10(17)9(14)16)5-8-7(11(18)19)4-12-6-13-8/h2-4,6H,5H2,1H3,(H,18,19) |
| InChIKey | SHJALBGTZFPJLM-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|