C12H9ClFIN2O2 — CID 102974936
3-[(3-chloro-4-fluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione (PubChem CID 102974936) has the molecular formula C12H9ClFIN2O2 and a molecular weight of 394.57 g/mol. Its IUPAC name is 3-[(3-chloro-4-fluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione.
| Compound Name | 3-[(3-chloro-4-fluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102974936 |
| Molecular Formula | C12H9ClFIN2O2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 3-[(3-chloro-4-fluorophenyl)methyl]-5-iodo-1-methylpyrimidine-2,4-dione |
| SMILES | Cn1cc(I)c(=O)n(Cc2ccc(F)c(Cl)c2)c1=O |
| InChI | InChI=1S/C12H9ClFIN2O2/c1-16-6-10(15)11(18)17(12(16)19)5-7-2-3-9(14)8(13)4-7/h2-4,6H,5H2,1H3 |
| InChIKey | PZWYDGUCPIZMIR-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|