C24H18Cl2N4O — CID 10297573
4-[[6-chloro-2-(3-chlorophenyl)-3-pyridinyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile (PubChem CID 10297573) has the molecular formula C24H18Cl2N4O and a molecular weight of 449.34 g/mol. Its IUPAC name is 4-[[6-chloro-2-(3-chlorophenyl)-3-pyridinyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile.
| Compound Name | 4-[[6-chloro-2-(3-chlorophenyl)-3-pyridinyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 10297573 |
| Molecular Formula | C24H18Cl2N4O |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 4-[[6-chloro-2-(3-chlorophenyl)-3-pyridinyl]methoxy-(3-methylimidazol-4-yl)methyl]benzonitrile |
| SMILES | Cn1cncc1C(OCc1ccc(Cl)nc1-c1cccc(Cl)c1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C24H18Cl2N4O/c1-30-15-28-13-21(30)24(17-7-5-16(12-27)6-8-17)31-14-19-9-10-22(26)29-23(19)18-3-2-4-20(25)11-18/h2-11,13,15,24H,14H2,1H3 |
| InChIKey | IFBXFLCRVVJFBJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|