C12H20ClNO2S — CID 102976607
1-[1-(5-chlorothiophen-3-yl)ethylamino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 102976607) has the molecular formula C12H20ClNO2S and a molecular weight of 277.82 g/mol. Its IUPAC name is 1-[1-(5-chlorothiophen-3-yl)ethylamino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[1-(5-chlorothiophen-3-yl)ethylamino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 102976607 |
| Molecular Formula | C12H20ClNO2S |
| Molecular Weight | 277.82 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 1-[1-(5-chlorothiophen-3-yl)ethylamino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNC(C)c1csc(Cl)c1 |
| InChI | InChI=1S/C12H20ClNO2S/c1-9(10-6-11(13)17-7-10)14-8-12(2,15)4-5-16-3/h6-7,9,14-15H,4-5,8H2,1-3H3 |
| InChIKey | DCSIULXPTODUGH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.82 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |