C14H21BrFNO2 — CID 103784174
1-[1-(3-bromo-4-fluorophenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 103784174) has the molecular formula C14H21BrFNO2 and a molecular weight of 334.23 g/mol. Its IUPAC name is 1-[1-(3-bromo-4-fluorophenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[1-(3-bromo-4-fluorophenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 103784174 |
| Molecular Formula | C14H21BrFNO2 |
| Molecular Weight | 334.23 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 1-[1-(3-bromo-4-fluorophenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNC(C)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C14H21BrFNO2/c1-10(11-4-5-13(16)12(15)8-11)17-9-14(2,18)6-7-19-3/h4-5,8,10,17-18H,6-7,9H2,1-3H3 |
| InChIKey | QXJGEMNZSAITHM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |