C15H24FNO3 — CID 103784211
1-[1-(2-fluoro-6-methoxyphenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 103784211) has the molecular formula C15H24FNO3 and a molecular weight of 285.36 g/mol. Its IUPAC name is 1-[1-(2-fluoro-6-methoxyphenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[1-(2-fluoro-6-methoxyphenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 103784211 |
| Molecular Formula | C15H24FNO3 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-[1-(2-fluoro-6-methoxyphenyl)ethylamino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNC(C)c1c(F)cccc1OC |
| InChI | InChI=1S/C15H24FNO3/c1-11(17-10-15(2,18)8-9-19-3)14-12(16)6-5-7-13(14)20-4/h5-7,11,17-18H,8-10H2,1-4H3 |
| InChIKey | PXBQMURCLDLIRR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |