C17H25ClN2O2S — CID 102976986
tert-butyl 4-[[1-(5-chlorothiophen-3-yl)ethylamino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 102976986) has the molecular formula C17H25ClN2O2S and a molecular weight of 356.92 g/mol. Its IUPAC name is tert-butyl 4-[[1-(5-chlorothiophen-3-yl)ethylamino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 4-[[1-(5-chlorothiophen-3-yl)ethylamino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 102976986 |
| Molecular Formula | C17H25ClN2O2S |
| Molecular Weight | 356.92 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | tert-butyl 4-[[1-(5-chlorothiophen-3-yl)ethylamino]methyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC(NCC1=CCN(C(=O)OC(C)(C)C)CC1)c1csc(Cl)c1 |
| InChI | InChI=1S/C17H25ClN2O2S/c1-12(14-9-15(18)23-11-14)19-10-13-5-7-20(8-6-13)16(21)22-17(2,3)4/h5,9,11-12,19H,6-8,10H2,1-4H3 |
| InChIKey | LIDFGEZDYKDZOK-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.92 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|