C10H15BrN2S — CID 102977244
(3R)-1-[(5-bromothiophen-3-yl)methyl]piperidin-3-amine (PubChem CID 102977244) has the molecular formula C10H15BrN2S and a molecular weight of 275.21 g/mol. Its IUPAC name is (3R)-1-[(5-bromothiophen-3-yl)methyl]piperidin-3-amine.
| Compound Name | (3R)-1-[(5-bromothiophen-3-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 102977244 |
| Molecular Formula | C10H15BrN2S |
| Molecular Weight | 275.21 g/mol |
| Exact Mass | 274.01 |
| IUPAC Name | (3R)-1-[(5-bromothiophen-3-yl)methyl]piperidin-3-amine |
| SMILES | N[C@@H]1CCCN(Cc2csc(Br)c2)C1 |
| InChI | InChI=1S/C10H15BrN2S/c11-10-4-8(7-14-10)5-13-3-1-2-9(12)6-13/h4,7,9H,1-3,5-6,12H2/t9-/m1/s1 |
| InChIKey | MDBTWDXZIGBWCR-SECBINFHSA-N |
| XLogP | 2.43 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |