C14H23ClN2 — CID 119910098
1-[(3,5-dimethylphenyl)methyl]piperidin-3-amine;hydrochloride (PubChem CID 119910098) has the molecular formula C14H23ClN2 and a molecular weight of 254.80 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methyl]piperidin-3-amine;hydrochloride.
| Compound Name | 1-[(3,5-dimethylphenyl)methyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119910098 |
| Molecular Formula | C14H23ClN2 |
| Molecular Weight | 254.80 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methyl]piperidin-3-amine;hydrochloride |
| SMILES | Cc1cc(C)cc(CN2CCCC(N)C2)c1.Cl |
| InChI | InChI=1S/C14H22N2.ClH/c1-11-6-12(2)8-13(7-11)9-16-5-3-4-14(15)10-16;/h6-8,14H,3-5,9-10,15H2,1-2H3;1H |
| InChIKey | KPFSRBYUMOJEKQ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |