C14H21N — CID 86880416
1-[(3,5-dimethylphenyl)methyl]-3-methylpyrrolidine (PubChem CID 86880416) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenyl)methyl]-3-methylpyrrolidine.
| Compound Name | 1-[(3,5-dimethylphenyl)methyl]-3-methylpyrrolidine |
|---|---|
| PubChem CID | 86880416 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-[(3,5-dimethylphenyl)methyl]-3-methylpyrrolidine |
| SMILES | Cc1cc(C)cc(CN2CCC(C)C2)c1 |
| InChI | InChI=1S/C14H21N/c1-11-4-5-15(9-11)10-14-7-12(2)6-13(3)8-14/h6-8,11H,4-5,9-10H2,1-3H3 |
| InChIKey | HAOUSYMOFHWVDT-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |