C14H20BrN — CID 80679343
4-bromo-1-[(3,5-dimethylphenyl)methyl]piperidine (PubChem CID 80679343) has the molecular formula C14H20BrN and a molecular weight of 282.23 g/mol. Its IUPAC name is 4-bromo-1-[(3,5-dimethylphenyl)methyl]piperidine.
| Compound Name | 4-bromo-1-[(3,5-dimethylphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 80679343 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-bromo-1-[(3,5-dimethylphenyl)methyl]piperidine |
| SMILES | Cc1cc(C)cc(CN2CCC(Br)CC2)c1 |
| InChI | InChI=1S/C14H20BrN/c1-11-7-12(2)9-13(8-11)10-16-5-3-14(15)4-6-16/h7-9,14H,3-6,10H2,1-2H3 |
| InChIKey | STULPDQMHPQVTP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|