C16H30F2N2O3 — CID 102978057
tert-butyl 3-[1-[2-(2,2-difluoroethoxy)ethylamino]ethyl]piperidine-1-carboxylate (PubChem CID 102978057) has the molecular formula C16H30F2N2O3 and a molecular weight of 336.42 g/mol. Its IUPAC name is tert-butyl 3-[1-[2-(2,2-difluoroethoxy)ethylamino]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[1-[2-(2,2-difluoroethoxy)ethylamino]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102978057 |
| Molecular Formula | C16H30F2N2O3 |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | tert-butyl 3-[1-[2-(2,2-difluoroethoxy)ethylamino]ethyl]piperidine-1-carboxylate |
| SMILES | CC(NCCOCC(F)F)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H30F2N2O3/c1-12(19-7-9-22-11-14(17)18)13-6-5-8-20(10-13)15(21)23-16(2,3)4/h12-14,19H,5-11H2,1-4H3 |
| InChIKey | NUQPATWDEPITRB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|