C20H21F3N2O3S2 — CID 10298126
(E)-3-cyclohexyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 10298126) has the molecular formula C20H21F3N2O3S2 and a molecular weight of 458.53 g/mol. Its IUPAC name is (E)-3-cyclohexyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-cyclohexyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 10298126 |
| Molecular Formula | C20H21F3N2O3S2 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (E)-3-cyclohexyl-2-[4-methylsulfonyl-3-(trifluoromethyl)phenyl]-N-(1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(/C(=C\C2CCCCC2)C(=O)Nc2nccs2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H21F3N2O3S2/c1-30(27,28)17-8-7-14(12-16(17)20(21,22)23)15(11-13-5-3-2-4-6-13)18(26)25-19-24-9-10-29-19/h7-13H,2-6H2,1H3,(H,24,25,26)/b15-11+ |
| InChIKey | YSLZNYGGLOZLPM-RVDMUPIBSA-N |
| XLogP | 5.17 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|