C7H14F3N3O2S — CID 102984427
(3R)-3-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide (PubChem CID 102984427) has the molecular formula C7H14F3N3O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is (3R)-3-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide.
| Compound Name | (3R)-3-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 102984427 |
| Molecular Formula | C7H14F3N3O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (3R)-3-amino-N-(2,2,2-trifluoroethyl)piperidine-1-sulfonamide |
| SMILES | N[C@@H]1CCCN(S(=O)(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C7H14F3N3O2S/c8-7(9,10)5-12-16(14,15)13-3-1-2-6(11)4-13/h6,12H,1-5,11H2/t6-/m1/s1 |
| InChIKey | SIEUZRGEETWYKR-ZCFIWIBFSA-N |
| XLogP | -0.19 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |