C7H14F3N3O2S — CID 104978203
(3S)-3-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 104978203) has the molecular formula C7H14F3N3O2S and a molecular weight of 261.27 g/mol. Its IUPAC name is (3S)-3-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
| Compound Name | (3S)-3-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 104978203 |
| Molecular Formula | C7H14F3N3O2S |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | (3S)-3-methyl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | C[C@H]1CN(S(=O)(=O)NCC(F)(F)F)CCN1 |
| InChI | InChI=1S/C7H14F3N3O2S/c1-6-4-13(3-2-11-6)16(14,15)12-5-7(8,9)10/h6,11-12H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | RDCWHECHJJULLM-LURJTMIESA-N |
| XLogP | -0.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |