C12H16F3N3O2S — CID 107388807
3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-sulfonamide (PubChem CID 107388807) has the molecular formula C12H16F3N3O2S and a molecular weight of 323.34 g/mol. Its IUPAC name is 3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-sulfonamide.
| Compound Name | 3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-sulfonamide |
|---|---|
| PubChem CID | 107388807 |
| Molecular Formula | C12H16F3N3O2S |
| Molecular Weight | 323.34 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-sulfonamide |
| SMILES | CC1CN(S(=O)(=O)NCC(F)(F)F)c2ccccc2CN1 |
| InChI | InChI=1S/C12H16F3N3O2S/c1-9-7-18(21(19,20)17-8-12(13,14)15)11-5-3-2-4-10(11)6-16-9/h2-5,9,16-17H,6-8H2,1H3 |
| InChIKey | RNZAXIYLJHEIMZ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |