C13H16F3N3O — CID 107388759
3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-carboxamide (PubChem CID 107388759) has the molecular formula C13H16F3N3O and a molecular weight of 287.29 g/mol. Its IUPAC name is 3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-carboxamide.
| Compound Name | 3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-carboxamide |
|---|---|
| PubChem CID | 107388759 |
| Molecular Formula | C13H16F3N3O |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-methyl-N-(2,2,2-trifluoroethyl)-2,3,4,5-tetrahydro-1,4-benzodiazepine-1-carboxamide |
| SMILES | CC1CN(C(=O)NCC(F)(F)F)c2ccccc2CN1 |
| InChI | InChI=1S/C13H16F3N3O/c1-9-7-19(12(20)18-8-13(14,15)16)11-5-3-2-4-10(11)6-17-9/h2-5,9,17H,6-8H2,1H3,(H,18,20) |
| InChIKey | MNSDWHUGMXLOPD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |