C27H18Cl2O4 — CID 10299285
(2R)-2-(2,6-dichloro-4-dibenzofuran-1-ylphenoxy)-3-phenylpropanoic acid (PubChem CID 10299285) has the molecular formula C27H18Cl2O4 and a molecular weight of 477.34 g/mol. Its IUPAC name is (2R)-2-(2,6-dichloro-4-dibenzofuran-1-ylphenoxy)-3-phenylpropanoic acid.
| Compound Name | (2R)-2-(2,6-dichloro-4-dibenzofuran-1-ylphenoxy)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 10299285 |
| Molecular Formula | C27H18Cl2O4 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | (2R)-2-(2,6-dichloro-4-dibenzofuran-1-ylphenoxy)-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)Oc1c(Cl)cc(-c2cccc3oc4ccccc4c23)cc1Cl |
| InChI | InChI=1S/C27H18Cl2O4/c28-20-14-17(18-10-6-12-23-25(18)19-9-4-5-11-22(19)32-23)15-21(29)26(20)33-24(27(30)31)13-16-7-2-1-3-8-16/h1-12,14-15,24H,13H2,(H,30,31)/t24-/m1/s1 |
| InChIKey | BUWQOSPLLBPKOK-XMMPIXPASA-N |
| XLogP | 7.63 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |