C7H13N3O — CID 102993784
2-(1,2,4-oxadiazol-5-yl)pentan-1-amine (PubChem CID 102993784) has the molecular formula C7H13N3O and a molecular weight of 155.20 g/mol. Its IUPAC name is 2-(1,2,4-oxadiazol-5-yl)pentan-1-amine.
| Compound Name | 2-(1,2,4-oxadiazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 102993784 |
| Molecular Formula | C7H13N3O |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 2-(1,2,4-oxadiazol-5-yl)pentan-1-amine |
| SMILES | CCCC(CN)c1ncno1 |
| InChI | InChI=1S/C7H13N3O/c1-2-3-6(4-8)7-9-5-10-11-7/h5-6H,2-4,8H2,1H3 |
| InChIKey | PIXFNSPPXCVEQK-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |