C8H15N3O — CID 65223012
2-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-1-amine (PubChem CID 65223012) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-1-amine.
| Compound Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
|---|---|
| PubChem CID | 65223012 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-(3-methyl-1,2,4-oxadiazol-5-yl)pentan-1-amine |
| SMILES | CCCC(CN)c1nc(C)no1 |
| InChI | InChI=1S/C8H15N3O/c1-3-4-7(5-9)8-10-6(2)11-12-8/h7H,3-5,9H2,1-2H3 |
| InChIKey | RICHXLAFGRQZSZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |