C26H30FN5O3 — CID 10299410
6-fluoro-4-methoxy-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide (PubChem CID 10299410) has the molecular formula C26H30FN5O3 and a molecular weight of 479.56 g/mol. Its IUPAC name is 6-fluoro-4-methoxy-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide.
| Compound Name | 6-fluoro-4-methoxy-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide |
|---|---|
| PubChem CID | 10299410 |
| Molecular Formula | C26H30FN5O3 |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 6-fluoro-4-methoxy-8-(4-methylpiperazin-1-yl)-N-(4-morpholin-4-ylphenyl)quinoline-2-carboxamide |
| SMILES | COc1cc(C(=O)Nc2ccc(N3CCOCC3)cc2)nc2c(N3CCN(C)CC3)cc(F)cc12 |
| InChI | InChI=1S/C26H30FN5O3/c1-30-7-9-32(10-8-30)23-16-18(27)15-21-24(34-2)17-22(29-25(21)23)26(33)28-19-3-5-20(6-4-19)31-11-13-35-14-12-31/h3-6,15-17H,7-14H2,1-2H3,(H,28,33) |
| InChIKey | IXZBMAVJNJWLBA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|