C27H26N6O3 — CID 10299591
1-[4-[[6-[3-(1,3-dioxolan-2-yl)propoxy]-3-pyridinyl]methylamino]phenyl]-4-pyridin-3-ylimidazole-2-carbonitrile (PubChem CID 10299591) has the molecular formula C27H26N6O3 and a molecular weight of 482.54 g/mol. Its IUPAC name is 1-[4-[[6-[3-(1,3-dioxolan-2-yl)propoxy]-3-pyridinyl]methylamino]phenyl]-4-pyridin-3-ylimidazole-2-carbonitrile.
| Compound Name | 1-[4-[[6-[3-(1,3-dioxolan-2-yl)propoxy]-3-pyridinyl]methylamino]phenyl]-4-pyridin-3-ylimidazole-2-carbonitrile |
|---|---|
| PubChem CID | 10299591 |
| Molecular Formula | C27H26N6O3 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 1-[4-[[6-[3-(1,3-dioxolan-2-yl)propoxy]-3-pyridinyl]methylamino]phenyl]-4-pyridin-3-ylimidazole-2-carbonitrile |
| SMILES | N#Cc1nc(-c2cccnc2)cn1-c1ccc(NCc2ccc(OCCCC3OCCO3)nc2)cc1 |
| InChI | InChI=1S/C27H26N6O3/c28-15-25-32-24(21-3-1-11-29-18-21)19-33(25)23-8-6-22(7-9-23)30-16-20-5-10-26(31-17-20)34-12-2-4-27-35-13-14-36-27/h1,3,5-11,17-19,27,30H,2,4,12-14,16H2 |
| InChIKey | LYLKMENDKFVYOO-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|