C14H31ClN2 — CID 102996112
N'-(5-chloropentyl)-N,N,N'-triethylpropane-1,3-diamine (PubChem CID 102996112) has the molecular formula C14H31ClN2 and a molecular weight of 262.87 g/mol. Its IUPAC name is N'-(5-chloropentyl)-N,N,N'-triethylpropane-1,3-diamine.
| Compound Name | N'-(5-chloropentyl)-N,N,N'-triethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 102996112 |
| Molecular Formula | C14H31ClN2 |
| Molecular Weight | 262.87 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N'-(5-chloropentyl)-N,N,N'-triethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CC)CCCCCCl |
| InChI | InChI=1S/C14H31ClN2/c1-4-16(5-2)13-10-14-17(6-3)12-9-7-8-11-15/h4-14H2,1-3H3 |
| InChIKey | ZCQACXTULRBFER-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.87 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|