C11H24Cl2N2 — CID 3022030
N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine (PubChem CID 3022030) has the molecular formula C11H24Cl2N2 and a molecular weight of 255.23 g/mol. Its IUPAC name is N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine.
| Compound Name | N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 3022030 |
| Molecular Formula | C11H24Cl2N2 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CCCl)CCCl |
| InChI | InChI=1S/C11H24Cl2N2/c1-3-14(4-2)8-5-9-15(10-6-12)11-7-13/h3-11H2,1-2H3 |
| InChIKey | YJDHKTCKUNTXPO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|