About N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine
N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine (PubChem CID 3022030) has the molecular formula C11H24Cl2N2
and a molecular weight of 255.23 g/mol. Its IUPAC name is N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine |
| PubChem CID | 3022030 |
| Molecular Formula | C11H24Cl2N2 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN(CCCl)CCCl |
| InChI | InChI=1S/C11H24Cl2N2/c1-3-14(4-2)8-5-9-15(10-6-12)11-7-13/h3-11H2,1-2H3 |
| InChIKey | YJDHKTCKUNTXPO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine?
The IUPAC name of N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine (CID 3022030) is N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine.
What is the SMILES notation for N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine?
The canonical SMILES for N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine is CCN(CC)CCCN(CCCl)CCCl.
What is the InChIKey of N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine?
The InChIKey is YJDHKTCKUNTXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24Cl2N2/c1-3-14(4-2)8-5-9-15(10-6-12)11-7-13/h3-11H2,1-2H3.
What are the key properties of N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine?
N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine has a molecular weight of 255.23 g/mol, XLogP of 2.50, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis(2-chloroethyl)-N,N-diethylpropane-1,3-diamine is sourced from PubChem (CID 3022030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).