C6H15Cl2NO — CID 19898497
2-chloro-N,N-diethylethanamine;hypochlorous acid (PubChem CID 19898497) has the molecular formula C6H15Cl2NO and a molecular weight of 188.10 g/mol. Its IUPAC name is 2-chloro-N,N-diethylethanamine;hypochlorous acid.
| Compound Name | 2-chloro-N,N-diethylethanamine;hypochlorous acid |
|---|---|
| PubChem CID | 19898497 |
| Molecular Formula | C6H15Cl2NO |
| Molecular Weight | 188.10 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-chloro-N,N-diethylethanamine;hypochlorous acid |
| SMILES | CCN(CC)CCCl.OCl |
| InChI | InChI=1S/C6H14ClN.ClHO/c1-3-8(4-2)6-5-7;1-2/h3-6H2,1-2H3;2H |
| InChIKey | QOUPJXLLBHPYEV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.10 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|