C8H20ClNOS — CID 159764523
2-chloro-N,N-diethylethanamine;methylsulfinylmethane (PubChem CID 159764523) has the molecular formula C8H20ClNOS and a molecular weight of 213.77 g/mol. Its IUPAC name is 2-chloro-N,N-diethylethanamine;methylsulfinylmethane.
| Compound Name | 2-chloro-N,N-diethylethanamine;methylsulfinylmethane |
|---|---|
| PubChem CID | 159764523 |
| Molecular Formula | C8H20ClNOS |
| Molecular Weight | 213.77 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-chloro-N,N-diethylethanamine;methylsulfinylmethane |
| SMILES | CCN(CC)CCCl.CS(C)=O |
| InChI | InChI=1S/C6H14ClN.C2H6OS/c1-3-8(4-2)6-5-7;1-4(2)3/h3-6H2,1-2H3;1-2H3 |
| InChIKey | NFIFWRWAORLNDW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.77 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|