C10H25N5 — CID 102999136
3-amino-1-[3-(dimethylamino)propyl]-1,2-diethylguanidine (PubChem CID 102999136) has the molecular formula C10H25N5 and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-amino-1-[3-(dimethylamino)propyl]-1,2-diethylguanidine.
| Compound Name | 3-amino-1-[3-(dimethylamino)propyl]-1,2-diethylguanidine |
|---|---|
| PubChem CID | 102999136 |
| Molecular Formula | C10H25N5 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.21 |
| IUPAC Name | 3-amino-1-[3-(dimethylamino)propyl]-1,2-diethylguanidine |
| SMILES | CC/N=C(\NN)N(CC)CCCN(C)C |
| InChI | InChI=1S/C10H25N5/c1-5-12-10(13-11)15(6-2)9-7-8-14(3)4/h5-9,11H2,1-4H3,(H,12,13) |
| InChIKey | GQYYPKJQQRXUDR-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|