C8H17F3N4 — CID 104887039
3-amino-1-methyl-2-propyl-1-(3,3,3-trifluoropropyl)guanidine (PubChem CID 104887039) has the molecular formula C8H17F3N4 and a molecular weight of 226.25 g/mol. Its IUPAC name is 3-amino-1-methyl-2-propyl-1-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 3-amino-1-methyl-2-propyl-1-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 104887039 |
| Molecular Formula | C8H17F3N4 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 3-amino-1-methyl-2-propyl-1-(3,3,3-trifluoropropyl)guanidine |
| SMILES | CCC/N=C(\NN)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C8H17F3N4/c1-3-5-13-7(14-12)15(2)6-4-8(9,10)11/h3-6,12H2,1-2H3,(H,13,14) |
| InChIKey | XKELDTNYKMCIPD-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|