C8H16F3N5 — CID 144561813
N,N,N'-trimethyl-N'-[3-(trifluoromethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]ethane-1,2-diamine (PubChem CID 144561813) has the molecular formula C8H16F3N5 and a molecular weight of 239.24 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[3-(trifluoromethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]ethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[3-(trifluoromethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 144561813 |
| Molecular Formula | C8H16F3N5 |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N,N,N'-trimethyl-N'-[3-(trifluoromethyl)-2,3-dihydro-1H-1,2,4-triazol-5-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCN(C)C1=NC(C(F)(F)F)NN1 |
| InChI | InChI=1S/C8H16F3N5/c1-15(2)4-5-16(3)7-12-6(13-14-7)8(9,10)11/h6,13H,4-5H2,1-3H3,(H,12,14) |
| InChIKey | KSPVWQGXEJIWEA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |