C8H18F2N4 — CID 104888974
3-amino-2-butyl-1-(2,2-difluoroethyl)-1-methylguanidine (PubChem CID 104888974) has the molecular formula C8H18F2N4 and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-amino-2-butyl-1-(2,2-difluoroethyl)-1-methylguanidine.
| Compound Name | 3-amino-2-butyl-1-(2,2-difluoroethyl)-1-methylguanidine |
|---|---|
| PubChem CID | 104888974 |
| Molecular Formula | C8H18F2N4 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 3-amino-2-butyl-1-(2,2-difluoroethyl)-1-methylguanidine |
| SMILES | CCCC/N=C(/NN)N(C)CC(F)F |
| InChI | InChI=1S/C8H18F2N4/c1-3-4-5-12-8(13-11)14(2)6-7(9)10/h7H,3-6,11H2,1-2H3,(H,12,13) |
| InChIKey | IZGCPGMQBJASKF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|