C14H33N5 — CID 102999148
3-amino-1-[3-(diethylamino)propyl]-1-ethyl-2-(2-methylpropyl)guanidine (PubChem CID 102999148) has the molecular formula C14H33N5 and a molecular weight of 271.45 g/mol. Its IUPAC name is 3-amino-1-[3-(diethylamino)propyl]-1-ethyl-2-(2-methylpropyl)guanidine.
| Compound Name | 3-amino-1-[3-(diethylamino)propyl]-1-ethyl-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 102999148 |
| Molecular Formula | C14H33N5 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.27 |
| IUPAC Name | 3-amino-1-[3-(diethylamino)propyl]-1-ethyl-2-(2-methylpropyl)guanidine |
| SMILES | CCN(CC)CCCN(CC)/C(=N\CC(C)C)NN |
| InChI | InChI=1S/C14H33N5/c1-6-18(7-2)10-9-11-19(8-3)14(17-15)16-12-13(4)5/h13H,6-12,15H2,1-5H3,(H,16,17) |
| InChIKey | QZDJDGQKSQWYBK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 56.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|