About N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine
N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine (PubChem CID 103000063) has the molecular formula C15H21FN4
and a molecular weight of 276.36 g/mol. Its IUPAC name is N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine |
| PubChem CID | 103000063 |
| Molecular Formula | C15H21FN4 |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine |
| SMILES | Cn1cc(CCN(CCCN)c2cccc(F)c2)cn1 |
| InChI | InChI=1S/C15H21FN4/c1-19-12-13(11-18-19)6-9-20(8-3-7-17)15-5-2-4-14(16)10-15/h2,4-5,10-12H,3,6-9,17H2,1H3 |
| InChIKey | RDHSZZYHMCDWCX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine?
The IUPAC name of N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine (CID 103000063) is N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine.
What is the SMILES notation for N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine?
The canonical SMILES for N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine is Cn1cc(CCN(CCCN)c2cccc(F)c2)cn1.
What is the InChIKey of N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine?
The InChIKey is RDHSZZYHMCDWCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21FN4/c1-19-12-13(11-18-19)6-9-20(8-3-7-17)15-5-2-4-14(16)10-15/h2,4-5,10-12H,3,6-9,17H2,1H3.
What are the key properties of N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine?
N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine has a molecular weight of 276.36 g/mol, XLogP of 1.96, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-fluorophenyl)-N'-[2-(1-methylpyrazol-4-yl)ethyl]propane-1,3-diamine is sourced from PubChem (CID 103000063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).