C28H30N2O4S — CID 10300081
methyl 6-[2-benzylsulfinyl-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoate (PubChem CID 10300081) has the molecular formula C28H30N2O4S and a molecular weight of 490.63 g/mol. Its IUPAC name is methyl 6-[2-benzylsulfinyl-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoate.
| Compound Name | methyl 6-[2-benzylsulfinyl-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoate |
|---|---|
| PubChem CID | 10300081 |
| Molecular Formula | C28H30N2O4S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | methyl 6-[2-benzylsulfinyl-3-(4-methylphenyl)benzimidazol-5-yl]oxyhexanoate |
| SMILES | COC(=O)CCCCCOc1ccc2nc(S(=O)Cc3ccccc3)n(-c3ccc(C)cc3)c2c1 |
| InChI | InChI=1S/C28H30N2O4S/c1-21-12-14-23(15-13-21)30-26-19-24(34-18-8-4-7-11-27(31)33-2)16-17-25(26)29-28(30)35(32)20-22-9-5-3-6-10-22/h3,5-6,9-10,12-17,19H,4,7-8,11,18,20H2,1-2H3 |
| InChIKey | VPGGTFNBKMPQRB-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|