C13H13N3O2S — CID 103001394
4-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)quinoline-4,7-diamine (PubChem CID 103001394) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)quinoline-4,7-diamine.
| Compound Name | 4-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103001394 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)quinoline-4,7-diamine |
| SMILES | Nc1ccc2c(NC3C=CS(=O)(=O)C3)ccnc2c1 |
| InChI | InChI=1S/C13H13N3O2S/c14-9-1-2-11-12(3-5-15-13(11)7-9)16-10-4-6-19(17,18)8-10/h1-7,10H,8,14H2,(H,15,16) |
| InChIKey | ZKBACYRMSPPCLN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|