C12H14FN3S — CID 103003142
5-fluoro-2-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]aniline (PubChem CID 103003142) has the molecular formula C12H14FN3S and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-fluoro-2-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]aniline.
| Compound Name | 5-fluoro-2-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]aniline |
|---|---|
| PubChem CID | 103003142 |
| Molecular Formula | C12H14FN3S |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-fluoro-2-[2-(2-methylpyrazol-3-yl)ethylsulfanyl]aniline |
| SMILES | Cn1nccc1CCSc1ccc(F)cc1N |
| InChI | InChI=1S/C12H14FN3S/c1-16-10(4-6-15-16)5-7-17-12-3-2-9(13)8-11(12)14/h2-4,6,8H,5,7,14H2,1H3 |
| InChIKey | JNPJEAAHTOXNTE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|